C15H17BrF2O3 — CID 114512828
2-[(4-bromo-2,5-difluorophenyl)-hydroxymethyl]-4-ethylcyclopentane-1-carboxylic acid (PubChem CID 114512828) has the molecular formula C15H17BrF2O3 and a molecular weight of 363.20 g/mol. Its IUPAC name is 2-[(4-bromo-2,5-difluorophenyl)-hydroxymethyl]-4-ethylcyclopentane-1-carboxylic acid.
| Compound Name | 2-[(4-bromo-2,5-difluorophenyl)-hydroxymethyl]-4-ethylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 114512828 |
| Molecular Formula | C15H17BrF2O3 |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | 2-[(4-bromo-2,5-difluorophenyl)-hydroxymethyl]-4-ethylcyclopentane-1-carboxylic acid |
| SMILES | CCC1CC(C(=O)O)C(C(O)c2cc(F)c(Br)cc2F)C1 |
| InChI | InChI=1S/C15H17BrF2O3/c1-2-7-3-8(9(4-7)15(20)21)14(19)10-5-13(18)11(16)6-12(10)17/h5-9,14,19H,2-4H2,1H3,(H,20,21) |
| InChIKey | HRAGYNVFZNNQRS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|