2-(2,5-dibromobenzoyl)-4-ethylcyclopentane-1-carboxylic acid

C15H16Br2O3 — CID 114512487

IUPAC2-(2,5-dibromobenzoyl)-4-ethylcyclopentane-1-carboxylic acid
SMILESCCC1CC(C(=O)O)C(C(=O)c2cc(Br)ccc2Br)C1
InChIInChI=1S/C15H16Br2O3/c1-2-8-5-10(11(6-8)15(19)20)14(18)12-7-9(16)3-4-13(12)17/h3-4,7-8,10-11H,2,5-6H2,1H3,(H,19,20)
InChIKeyOMUAHUDAOSAMMG-UHFFFAOYSA-N
MW404.10 g/mol
LogP4.53
Rot. Bonds4

About 2-(2,5-dibromobenzoyl)-4-ethylcyclopentane-1-carboxylic acid

2-(2,5-dibromobenzoyl)-4-ethylcyclopentane-1-carboxylic acid (PubChem CID 114512487) has the molecular formula C15H16Br2O3 and a molecular weight of 404.10 g/mol. Its IUPAC name is 2-(2,5-dibromobenzoyl)-4-ethylcyclopentane-1-carboxylic acid.

Molecular Properties

Compound Name2-(2,5-dibromobenzoyl)-4-ethylcyclopentane-1-carboxylic acid
PubChem CID114512487
Molecular FormulaC15H16Br2O3
Molecular Weight404.10 g/mol
Exact Mass401.95
IUPAC Name2-(2,5-dibromobenzoyl)-4-ethylcyclopentane-1-carboxylic acid
SMILESCCC1CC(C(=O)O)C(C(=O)c2cc(Br)ccc2Br)C1
InChIInChI=1S/C15H16Br2O3/c1-2-8-5-10(11(6-8)15(19)20)14(18)12-7-9(16)3-4-13(12)17/h3-4,7-8,10-11H,2,5-6H2,1H3,(H,19,20)
InChIKeyOMUAHUDAOSAMMG-UHFFFAOYSA-N
XLogP4.53
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500404.10
LogP ≤ 54.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(2,5-dibromobenzoyl)-4-ethylcyclopentane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,5-dibromobenzoyl)-4-ethylcyclopentane-1-carboxylic acid?
The IUPAC name of 2-(2,5-dibromobenzoyl)-4-ethylcyclopentane-1-carboxylic acid (CID 114512487) is 2-(2,5-dibromobenzoyl)-4-ethylcyclopentane-1-carboxylic acid.
What is the SMILES notation for 2-(2,5-dibromobenzoyl)-4-ethylcyclopentane-1-carboxylic acid?
The canonical SMILES for 2-(2,5-dibromobenzoyl)-4-ethylcyclopentane-1-carboxylic acid is CCC1CC(C(=O)O)C(C(=O)c2cc(Br)ccc2Br)C1.
What is the InChIKey of 2-(2,5-dibromobenzoyl)-4-ethylcyclopentane-1-carboxylic acid?
The InChIKey is OMUAHUDAOSAMMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16Br2O3/c1-2-8-5-10(11(6-8)15(19)20)14(18)12-7-9(16)3-4-13(12)17/h3-4,7-8,10-11H,2,5-6H2,1H3,(H,19,20).
What are the key properties of 2-(2,5-dibromobenzoyl)-4-ethylcyclopentane-1-carboxylic acid?
2-(2,5-dibromobenzoyl)-4-ethylcyclopentane-1-carboxylic acid has a molecular weight of 404.10 g/mol, XLogP of 4.53, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dibromobenzoyl)-4-ethylcyclopentane-1-carboxylic acid is sourced from PubChem (CID 114512487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).