C15H18Br2O — CID 114975946
(2,5-dibromophenyl)-(4-ethylcyclohexyl)methanone (PubChem CID 114975946) has the molecular formula C15H18Br2O and a molecular weight of 374.12 g/mol. Its IUPAC name is (2,5-dibromophenyl)-(4-ethylcyclohexyl)methanone.
| Compound Name | (2,5-dibromophenyl)-(4-ethylcyclohexyl)methanone |
|---|---|
| PubChem CID | 114975946 |
| Molecular Formula | C15H18Br2O |
| Molecular Weight | 374.12 g/mol |
| Exact Mass | 371.97 |
| IUPAC Name | (2,5-dibromophenyl)-(4-ethylcyclohexyl)methanone |
| SMILES | CCC1CCC(C(=O)c2cc(Br)ccc2Br)CC1 |
| InChI | InChI=1S/C15H18Br2O/c1-2-10-3-5-11(6-4-10)15(18)13-9-12(16)7-8-14(13)17/h7-11H,2-6H2,1H3 |
| InChIKey | YMSLCHCPSXXIIK-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.12 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |