C12H12Br2O — CID 114978303
3-cyclopropyl-1-(2,5-dibromophenyl)propan-1-one (PubChem CID 114978303) has the molecular formula C12H12Br2O and a molecular weight of 332.04 g/mol. Its IUPAC name is 3-cyclopropyl-1-(2,5-dibromophenyl)propan-1-one.
| Compound Name | 3-cyclopropyl-1-(2,5-dibromophenyl)propan-1-one |
|---|---|
| PubChem CID | 114978303 |
| Molecular Formula | C12H12Br2O |
| Molecular Weight | 332.04 g/mol |
| Exact Mass | 329.93 |
| IUPAC Name | 3-cyclopropyl-1-(2,5-dibromophenyl)propan-1-one |
| SMILES | O=C(CCC1CC1)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C12H12Br2O/c13-9-4-5-11(14)10(7-9)12(15)6-3-8-1-2-8/h4-5,7-8H,1-3,6H2 |
| InChIKey | RCUWWZLMVVKJNJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.04 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |