C15H18Cl2O — CID 65394546
(2,3-dichlorophenyl)-(4-ethylcyclohexyl)methanone (PubChem CID 65394546) has the molecular formula C15H18Cl2O and a molecular weight of 285.21 g/mol. Its IUPAC name is (2,3-dichlorophenyl)-(4-ethylcyclohexyl)methanone.
| Compound Name | (2,3-dichlorophenyl)-(4-ethylcyclohexyl)methanone |
|---|---|
| PubChem CID | 65394546 |
| Molecular Formula | C15H18Cl2O |
| Molecular Weight | 285.21 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | (2,3-dichlorophenyl)-(4-ethylcyclohexyl)methanone |
| SMILES | CCC1CCC(C(=O)c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C15H18Cl2O/c1-2-10-6-8-11(9-7-10)15(18)12-4-3-5-13(16)14(12)17/h3-5,10-11H,2,6-9H2,1H3 |
| InChIKey | KFQUUJOVKBIFFO-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.21 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |