C12H13BrF2O3 — CID 65297845
4-(4-bromo-2,5-difluorophenyl)-4-hydroxy-2,2-dimethylbutanoic acid (PubChem CID 65297845) has the molecular formula C12H13BrF2O3 and a molecular weight of 323.13 g/mol. Its IUPAC name is 4-(4-bromo-2,5-difluorophenyl)-4-hydroxy-2,2-dimethylbutanoic acid.
| Compound Name | 4-(4-bromo-2,5-difluorophenyl)-4-hydroxy-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 65297845 |
| Molecular Formula | C12H13BrF2O3 |
| Molecular Weight | 323.13 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 4-(4-bromo-2,5-difluorophenyl)-4-hydroxy-2,2-dimethylbutanoic acid |
| SMILES | CC(C)(CC(O)c1cc(F)c(Br)cc1F)C(=O)O |
| InChI | InChI=1S/C12H13BrF2O3/c1-12(2,11(17)18)5-10(16)6-3-9(15)7(13)4-8(6)14/h3-4,10,16H,5H2,1-2H3,(H,17,18) |
| InChIKey | CYPLTKAEXYAYOO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.13 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|