C13H13BrClFO3 — CID 105399251
2-[(4-bromo-5-chloro-2-fluorophenyl)-hydroxymethyl]cyclopentane-1-carboxylic acid (PubChem CID 105399251) has the molecular formula C13H13BrClFO3 and a molecular weight of 351.60 g/mol. Its IUPAC name is 2-[(4-bromo-5-chloro-2-fluorophenyl)-hydroxymethyl]cyclopentane-1-carboxylic acid.
| Compound Name | 2-[(4-bromo-5-chloro-2-fluorophenyl)-hydroxymethyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 105399251 |
| Molecular Formula | C13H13BrClFO3 |
| Molecular Weight | 351.60 g/mol |
| Exact Mass | 349.97 |
| IUPAC Name | 2-[(4-bromo-5-chloro-2-fluorophenyl)-hydroxymethyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCC1C(O)c1cc(Cl)c(Br)cc1F |
| InChI | InChI=1S/C13H13BrClFO3/c14-9-5-11(16)8(4-10(9)15)12(17)6-2-1-3-7(6)13(18)19/h4-7,12,17H,1-3H2,(H,18,19) |
| InChIKey | CXKXUHFOQJYLIK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.60 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|