C11H12BrClO3S — CID 102829020
2-[(4-bromo-5-chlorothiophen-2-yl)-hydroxymethyl]cyclopentane-1-carboxylic acid (PubChem CID 102829020) has the molecular formula C11H12BrClO3S and a molecular weight of 339.64 g/mol. Its IUPAC name is 2-[(4-bromo-5-chlorothiophen-2-yl)-hydroxymethyl]cyclopentane-1-carboxylic acid.
| Compound Name | 2-[(4-bromo-5-chlorothiophen-2-yl)-hydroxymethyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 102829020 |
| Molecular Formula | C11H12BrClO3S |
| Molecular Weight | 339.64 g/mol |
| Exact Mass | 337.94 |
| IUPAC Name | 2-[(4-bromo-5-chlorothiophen-2-yl)-hydroxymethyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCC1C(O)c1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C11H12BrClO3S/c12-7-4-8(17-10(7)13)9(14)5-2-1-3-6(5)11(15)16/h4-6,9,14H,1-3H2,(H,15,16) |
| InChIKey | PQVDUFSMFLDLTL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.64 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |