C12H16BrClO3S2 — CID 102830337
(4-bromo-5-chlorothiophen-2-yl)-(3-methylsulfonylcyclohexyl)methanol (PubChem CID 102830337) has the molecular formula C12H16BrClO3S2 and a molecular weight of 387.75 g/mol. Its IUPAC name is (4-bromo-5-chlorothiophen-2-yl)-(3-methylsulfonylcyclohexyl)methanol.
| Compound Name | (4-bromo-5-chlorothiophen-2-yl)-(3-methylsulfonylcyclohexyl)methanol |
|---|---|
| PubChem CID | 102830337 |
| Molecular Formula | C12H16BrClO3S2 |
| Molecular Weight | 387.75 g/mol |
| Exact Mass | 385.94 |
| IUPAC Name | (4-bromo-5-chlorothiophen-2-yl)-(3-methylsulfonylcyclohexyl)methanol |
| SMILES | CS(=O)(=O)C1CCCC(C(O)c2cc(Br)c(Cl)s2)C1 |
| InChI | InChI=1S/C12H16BrClO3S2/c1-19(16,17)8-4-2-3-7(5-8)11(15)10-6-9(13)12(14)18-10/h6-8,11,15H,2-5H2,1H3 |
| InChIKey | ARXXRABHFZLMAI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.75 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |