C12H16Cl2O3S2 — CID 107969794
(2,5-dichlorothiophen-3-yl)-(3-methylsulfonylcyclohexyl)methanol (PubChem CID 107969794) has the molecular formula C12H16Cl2O3S2 and a molecular weight of 343.30 g/mol. Its IUPAC name is (2,5-dichlorothiophen-3-yl)-(3-methylsulfonylcyclohexyl)methanol.
| Compound Name | (2,5-dichlorothiophen-3-yl)-(3-methylsulfonylcyclohexyl)methanol |
|---|---|
| PubChem CID | 107969794 |
| Molecular Formula | C12H16Cl2O3S2 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | (2,5-dichlorothiophen-3-yl)-(3-methylsulfonylcyclohexyl)methanol |
| SMILES | CS(=O)(=O)C1CCCC(C(O)c2cc(Cl)sc2Cl)C1 |
| InChI | InChI=1S/C12H16Cl2O3S2/c1-19(16,17)8-4-2-3-7(5-8)11(15)9-6-10(13)18-12(9)14/h6-8,11,15H,2-5H2,1H3 |
| InChIKey | AERNEMVHLGINBC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |