C15H20N2O3S — CID 103129058
(3-methylsulfonylcyclohexyl)-pyrazolo[1,5-a]pyridin-3-ylmethanol (PubChem CID 103129058) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is (3-methylsulfonylcyclohexyl)-pyrazolo[1,5-a]pyridin-3-ylmethanol.
| Compound Name | (3-methylsulfonylcyclohexyl)-pyrazolo[1,5-a]pyridin-3-ylmethanol |
|---|---|
| PubChem CID | 103129058 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | (3-methylsulfonylcyclohexyl)-pyrazolo[1,5-a]pyridin-3-ylmethanol |
| SMILES | CS(=O)(=O)C1CCCC(C(O)c2cnn3ccccc23)C1 |
| InChI | InChI=1S/C15H20N2O3S/c1-21(19,20)12-6-4-5-11(9-12)15(18)13-10-16-17-8-3-2-7-14(13)17/h2-3,7-8,10-12,15,18H,4-6,9H2,1H3 |
| InChIKey | XKTJKZAYOXIOHA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |