C14H18BrFO3S — CID 115822082
(2-bromo-4-fluorophenyl)-(3-methylsulfonylcyclohexyl)methanol (PubChem CID 115822082) has the molecular formula C14H18BrFO3S and a molecular weight of 365.26 g/mol. Its IUPAC name is (2-bromo-4-fluorophenyl)-(3-methylsulfonylcyclohexyl)methanol.
| Compound Name | (2-bromo-4-fluorophenyl)-(3-methylsulfonylcyclohexyl)methanol |
|---|---|
| PubChem CID | 115822082 |
| Molecular Formula | C14H18BrFO3S |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | (2-bromo-4-fluorophenyl)-(3-methylsulfonylcyclohexyl)methanol |
| SMILES | CS(=O)(=O)C1CCCC(C(O)c2ccc(F)cc2Br)C1 |
| InChI | InChI=1S/C14H18BrFO3S/c1-20(18,19)11-4-2-3-9(7-11)14(17)12-6-5-10(16)8-13(12)15/h5-6,8-9,11,14,17H,2-4,7H2,1H3 |
| InChIKey | XYQGKHBONXOGJR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |