C15H21BrFNO2S — CID 105014165
1-(2-bromo-5-fluorophenyl)-N-methyl-1-(3-methylsulfonylcyclohexyl)methanamine (PubChem CID 105014165) has the molecular formula C15H21BrFNO2S and a molecular weight of 378.31 g/mol. Its IUPAC name is 1-(2-bromo-5-fluorophenyl)-N-methyl-1-(3-methylsulfonylcyclohexyl)methanamine.
| Compound Name | 1-(2-bromo-5-fluorophenyl)-N-methyl-1-(3-methylsulfonylcyclohexyl)methanamine |
|---|---|
| PubChem CID | 105014165 |
| Molecular Formula | C15H21BrFNO2S |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 1-(2-bromo-5-fluorophenyl)-N-methyl-1-(3-methylsulfonylcyclohexyl)methanamine |
| SMILES | CNC(c1cc(F)ccc1Br)C1CCCC(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C15H21BrFNO2S/c1-18-15(13-9-11(17)6-7-14(13)16)10-4-3-5-12(8-10)21(2,19)20/h6-7,9-10,12,15,18H,3-5,8H2,1-2H3 |
| InChIKey | YXUWVLFAUYOCNJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |