C16H24BrNO2S — CID 105014289
1-(4-bromo-3-methylphenyl)-N-methyl-1-(3-methylsulfonylcyclohexyl)methanamine (PubChem CID 105014289) has the molecular formula C16H24BrNO2S and a molecular weight of 374.34 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-N-methyl-1-(3-methylsulfonylcyclohexyl)methanamine.
| Compound Name | 1-(4-bromo-3-methylphenyl)-N-methyl-1-(3-methylsulfonylcyclohexyl)methanamine |
|---|---|
| PubChem CID | 105014289 |
| Molecular Formula | C16H24BrNO2S |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-N-methyl-1-(3-methylsulfonylcyclohexyl)methanamine |
| SMILES | CNC(c1ccc(Br)c(C)c1)C1CCCC(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C16H24BrNO2S/c1-11-9-13(7-8-15(11)17)16(18-2)12-5-4-6-14(10-12)21(3,19)20/h7-9,12,14,16,18H,4-6,10H2,1-3H3 |
| InChIKey | GAGUIPXYBSSGNJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |