C16H23BrO3S — CID 114329804
(4-bromo-3,5-dimethylphenyl)-(3-methylsulfonylcyclohexyl)methanol (PubChem CID 114329804) has the molecular formula C16H23BrO3S and a molecular weight of 375.33 g/mol. Its IUPAC name is (4-bromo-3,5-dimethylphenyl)-(3-methylsulfonylcyclohexyl)methanol.
| Compound Name | (4-bromo-3,5-dimethylphenyl)-(3-methylsulfonylcyclohexyl)methanol |
|---|---|
| PubChem CID | 114329804 |
| Molecular Formula | C16H23BrO3S |
| Molecular Weight | 375.33 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | (4-bromo-3,5-dimethylphenyl)-(3-methylsulfonylcyclohexyl)methanol |
| SMILES | Cc1cc(C(O)C2CCCC(S(C)(=O)=O)C2)cc(C)c1Br |
| InChI | InChI=1S/C16H23BrO3S/c1-10-7-13(8-11(2)15(10)17)16(18)12-5-4-6-14(9-12)21(3,19)20/h7-8,12,14,16,18H,4-6,9H2,1-3H3 |
| InChIKey | ZXTCEHVGVHNQJX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |