C15H23NO3S — CID 107502764
(2,6-dimethyl-4-pyridinyl)-(3-methylsulfonylcyclohexyl)methanol (PubChem CID 107502764) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is (2,6-dimethyl-4-pyridinyl)-(3-methylsulfonylcyclohexyl)methanol.
| Compound Name | (2,6-dimethyl-4-pyridinyl)-(3-methylsulfonylcyclohexyl)methanol |
|---|---|
| PubChem CID | 107502764 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (2,6-dimethyl-4-pyridinyl)-(3-methylsulfonylcyclohexyl)methanol |
| SMILES | Cc1cc(C(O)C2CCCC(S(C)(=O)=O)C2)cc(C)n1 |
| InChI | InChI=1S/C15H23NO3S/c1-10-7-13(8-11(2)16-10)15(17)12-5-4-6-14(9-12)20(3,18)19/h7-8,12,14-15,17H,4-6,9H2,1-3H3 |
| InChIKey | ZOCKDXLBXUOOER-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |