C14H19BrFNO2S — CID 105014355
(2-bromo-3-fluorophenyl)-(3-methylsulfonylcyclohexyl)methanamine (PubChem CID 105014355) has the molecular formula C14H19BrFNO2S and a molecular weight of 364.28 g/mol. Its IUPAC name is (2-bromo-3-fluorophenyl)-(3-methylsulfonylcyclohexyl)methanamine.
| Compound Name | (2-bromo-3-fluorophenyl)-(3-methylsulfonylcyclohexyl)methanamine |
|---|---|
| PubChem CID | 105014355 |
| Molecular Formula | C14H19BrFNO2S |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | (2-bromo-3-fluorophenyl)-(3-methylsulfonylcyclohexyl)methanamine |
| SMILES | CS(=O)(=O)C1CCCC(C(N)c2cccc(F)c2Br)C1 |
| InChI | InChI=1S/C14H19BrFNO2S/c1-20(18,19)10-5-2-4-9(8-10)14(17)11-6-3-7-12(16)13(11)15/h3,6-7,9-10,14H,2,4-5,8,17H2,1H3 |
| InChIKey | YBFCWSKPRZAAFA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |