C15H22BrNO3S — CID 105014385
(4-bromo-2-methoxyphenyl)-(3-methylsulfonylcyclohexyl)methanamine (PubChem CID 105014385) has the molecular formula C15H22BrNO3S and a molecular weight of 376.32 g/mol. Its IUPAC name is (4-bromo-2-methoxyphenyl)-(3-methylsulfonylcyclohexyl)methanamine.
| Compound Name | (4-bromo-2-methoxyphenyl)-(3-methylsulfonylcyclohexyl)methanamine |
|---|---|
| PubChem CID | 105014385 |
| Molecular Formula | C15H22BrNO3S |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | (4-bromo-2-methoxyphenyl)-(3-methylsulfonylcyclohexyl)methanamine |
| SMILES | COc1cc(Br)ccc1C(N)C1CCCC(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C15H22BrNO3S/c1-20-14-9-11(16)6-7-13(14)15(17)10-4-3-5-12(8-10)21(2,18)19/h6-7,9-10,12,15H,3-5,8,17H2,1-2H3 |
| InChIKey | JXMKPNBOTYWTDW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |