C15H19NO2S2 — CID 64905569
N-[1-benzothiophen-3-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine (PubChem CID 64905569) has the molecular formula C15H19NO2S2 and a molecular weight of 309.46 g/mol. Its IUPAC name is N-[1-benzothiophen-3-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine.
| Compound Name | N-[1-benzothiophen-3-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 64905569 |
| Molecular Formula | C15H19NO2S2 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | N-[1-benzothiophen-3-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine |
| SMILES | CCNC(c1csc2ccccc12)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H19NO2S2/c1-2-16-15(11-7-8-20(17,18)10-11)13-9-19-14-6-4-3-5-12(13)14/h3-6,9,11,15-16H,2,7-8,10H2,1H3 |
| InChIKey | MGUGZMKSXQTCTQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |