About 3-[chloro(cyclohexyl)methyl]-1-benzothiophene;thionyl dichloride
3-[chloro(cyclohexyl)methyl]-1-benzothiophene;thionyl dichloride (PubChem CID 159655560) has the molecular formula C15H17Cl3OS2
and a molecular weight of 383.79 g/mol. Its IUPAC name is 3-[chloro(cyclohexyl)methyl]-1-benzothiophene;thionyl dichloride.
Molecular Properties
| Compound Name | 3-[chloro(cyclohexyl)methyl]-1-benzothiophene;thionyl dichloride |
| PubChem CID | 159655560 |
| Molecular Formula | C15H17Cl3OS2 |
| Molecular Weight | 383.79 g/mol |
| Exact Mass | 381.98 |
| IUPAC Name | 3-[chloro(cyclohexyl)methyl]-1-benzothiophene;thionyl dichloride |
| SMILES | ClC(c1csc2ccccc12)C1CCCCC1.O=S(Cl)Cl |
| InChI | InChI=1S/C15H17ClS.Cl2OS/c16-15(11-6-2-1-3-7-11)13-10-17-14-9-5-4-8-12(13)14;1-4(2)3/h4-5,8-11,15H,1-3,6-7H2; |
| InChIKey | MSCZAWWMZYDMCI-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.79 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[chloro(cyclohexyl)methyl]-1-benzothiophene;thionyl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[chloro(cyclohexyl)methyl]-1-benzothiophene;thionyl dichloride?
The IUPAC name of 3-[chloro(cyclohexyl)methyl]-1-benzothiophene;thionyl dichloride (CID 159655560) is 3-[chloro(cyclohexyl)methyl]-1-benzothiophene;thionyl dichloride.
What is the SMILES notation for 3-[chloro(cyclohexyl)methyl]-1-benzothiophene;thionyl dichloride?
The canonical SMILES for 3-[chloro(cyclohexyl)methyl]-1-benzothiophene;thionyl dichloride is ClC(c1csc2ccccc12)C1CCCCC1.O=S(Cl)Cl.
What is the InChIKey of 3-[chloro(cyclohexyl)methyl]-1-benzothiophene;thionyl dichloride?
The InChIKey is MSCZAWWMZYDMCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17ClS.Cl2OS/c16-15(11-6-2-1-3-7-11)13-10-17-14-9-5-4-8-12(13)14;1-4(2)3/h4-5,8-11,15H,1-3,6-7H2;.
What are the key properties of 3-[chloro(cyclohexyl)methyl]-1-benzothiophene;thionyl dichloride?
3-[chloro(cyclohexyl)methyl]-1-benzothiophene;thionyl dichloride has a molecular weight of 383.79 g/mol, XLogP of 6.80, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[chloro(cyclohexyl)methyl]-1-benzothiophene;thionyl dichloride is sourced from PubChem (CID 159655560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).