C22H23NO2S — CID 66777972
4-[[1-benzothiophen-3-yl(cyclohexyl)methyl]amino]benzoic acid (PubChem CID 66777972) has the molecular formula C22H23NO2S and a molecular weight of 365.50 g/mol. Its IUPAC name is 4-[[1-benzothiophen-3-yl(cyclohexyl)methyl]amino]benzoic acid.
| Compound Name | 4-[[1-benzothiophen-3-yl(cyclohexyl)methyl]amino]benzoic acid |
|---|---|
| PubChem CID | 66777972 |
| Molecular Formula | C22H23NO2S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 4-[[1-benzothiophen-3-yl(cyclohexyl)methyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(c2csc3ccccc23)C2CCCCC2)cc1 |
| InChI | InChI=1S/C22H23NO2S/c24-22(25)16-10-12-17(13-11-16)23-21(15-6-2-1-3-7-15)19-14-26-20-9-5-4-8-18(19)20/h4-5,8-15,21,23H,1-3,6-7H2,(H,24,25) |
| InChIKey | UBIYQSBVQFNSBF-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |