C27H35NO3S — CID 68516586
4-[[[5-(cyclohexanecarbonyl)-2-ethylthiophen-3-yl]-cyclohexylmethyl]amino]benzoic acid (PubChem CID 68516586) has the molecular formula C27H35NO3S and a molecular weight of 453.65 g/mol. Its IUPAC name is 4-[[[5-(cyclohexanecarbonyl)-2-ethylthiophen-3-yl]-cyclohexylmethyl]amino]benzoic acid.
| Compound Name | 4-[[[5-(cyclohexanecarbonyl)-2-ethylthiophen-3-yl]-cyclohexylmethyl]amino]benzoic acid |
|---|---|
| PubChem CID | 68516586 |
| Molecular Formula | C27H35NO3S |
| Molecular Weight | 453.65 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 4-[[[5-(cyclohexanecarbonyl)-2-ethylthiophen-3-yl]-cyclohexylmethyl]amino]benzoic acid |
| SMILES | CCc1sc(C(=O)C2CCCCC2)cc1C(Nc1ccc(C(=O)O)cc1)C1CCCCC1 |
| InChI | InChI=1S/C27H35NO3S/c1-2-23-22(17-24(32-23)26(29)19-11-7-4-8-12-19)25(18-9-5-3-6-10-18)28-21-15-13-20(14-16-21)27(30)31/h13-19,25,28H,2-12H2,1H3,(H,30,31) |
| InChIKey | IALRGINZFMAFPG-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.65 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |