C27H32N2O5 — CID 68511428
4-[[cyclohexyl-[5-[6-(2-methoxyethoxy)-3-pyridinyl]-2-methylfuran-3-yl]methyl]amino]benzoic acid (PubChem CID 68511428) has the molecular formula C27H32N2O5 and a molecular weight of 464.56 g/mol. Its IUPAC name is 4-[[cyclohexyl-[5-[6-(2-methoxyethoxy)-3-pyridinyl]-2-methylfuran-3-yl]methyl]amino]benzoic acid.
| Compound Name | 4-[[cyclohexyl-[5-[6-(2-methoxyethoxy)-3-pyridinyl]-2-methylfuran-3-yl]methyl]amino]benzoic acid |
|---|---|
| PubChem CID | 68511428 |
| Molecular Formula | C27H32N2O5 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | 4-[[cyclohexyl-[5-[6-(2-methoxyethoxy)-3-pyridinyl]-2-methylfuran-3-yl]methyl]amino]benzoic acid |
| SMILES | COCCOc1ccc(-c2cc(C(Nc3ccc(C(=O)O)cc3)C3CCCCC3)c(C)o2)cn1 |
| InChI | InChI=1S/C27H32N2O5/c1-18-23(16-24(34-18)21-10-13-25(28-17-21)33-15-14-32-2)26(19-6-4-3-5-7-19)29-22-11-8-20(9-12-22)27(30)31/h8-13,16-17,19,26,29H,3-7,14-15H2,1-2H3,(H,30,31) |
| InChIKey | SVFNDJYPZSIVGU-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|