C30H37N3O3 — CID 68563101
3-[4-[cyclohexyl-[4-[methyl(propyl)carbamoyl]anilino]methyl]-5-methylfuran-2-yl]benzamide (PubChem CID 68563101) has the molecular formula C30H37N3O3 and a molecular weight of 487.64 g/mol. Its IUPAC name is 3-[4-[cyclohexyl-[4-[methyl(propyl)carbamoyl]anilino]methyl]-5-methylfuran-2-yl]benzamide.
| Compound Name | 3-[4-[cyclohexyl-[4-[methyl(propyl)carbamoyl]anilino]methyl]-5-methylfuran-2-yl]benzamide |
|---|---|
| PubChem CID | 68563101 |
| Molecular Formula | C30H37N3O3 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | 3-[4-[cyclohexyl-[4-[methyl(propyl)carbamoyl]anilino]methyl]-5-methylfuran-2-yl]benzamide |
| SMILES | CCCN(C)C(=O)c1ccc(NC(c2cc(-c3cccc(C(N)=O)c3)oc2C)C2CCCCC2)cc1 |
| InChI | InChI=1S/C30H37N3O3/c1-4-17-33(3)30(35)22-13-15-25(16-14-22)32-28(21-9-6-5-7-10-21)26-19-27(36-20(26)2)23-11-8-12-24(18-23)29(31)34/h8,11-16,18-19,21,28,32H,4-7,9-10,17H2,1-3H3,(H2,31,34) |
| InChIKey | SNFDRLOJSHGYGL-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |