C27H32N2O4 — CID 59529370
3-[methyl-[4-[1-(2-methyl-5-phenylfuran-3-yl)pentylamino]benzoyl]amino]propanoic acid (PubChem CID 59529370) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is 3-[methyl-[4-[1-(2-methyl-5-phenylfuran-3-yl)pentylamino]benzoyl]amino]propanoic acid.
| Compound Name | 3-[methyl-[4-[1-(2-methyl-5-phenylfuran-3-yl)pentylamino]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 59529370 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 3-[methyl-[4-[1-(2-methyl-5-phenylfuran-3-yl)pentylamino]benzoyl]amino]propanoic acid |
| SMILES | CCCCC(Nc1ccc(C(=O)N(C)CCC(=O)O)cc1)c1cc(-c2ccccc2)oc1C |
| InChI | InChI=1S/C27H32N2O4/c1-4-5-11-24(23-18-25(33-19(23)2)20-9-7-6-8-10-20)28-22-14-12-21(13-15-22)27(32)29(3)17-16-26(30)31/h6-10,12-15,18,24,28H,4-5,11,16-17H2,1-3H3,(H,30,31) |
| InChIKey | BAVVUNCALDUDGL-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |