C27H30N2O4 — CID 143799638
3-[[4-[1-(2-cyclopropyl-5-phenylfuran-3-yl)butylamino]benzoyl]amino]propanoic acid (PubChem CID 143799638) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is 3-[[4-[1-(2-cyclopropyl-5-phenylfuran-3-yl)butylamino]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[1-(2-cyclopropyl-5-phenylfuran-3-yl)butylamino]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 143799638 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 3-[[4-[1-(2-cyclopropyl-5-phenylfuran-3-yl)butylamino]benzoyl]amino]propanoic acid |
| SMILES | CCCC(Nc1ccc(C(=O)NCCC(=O)O)cc1)c1cc(-c2ccccc2)oc1C1CC1 |
| InChI | InChI=1S/C27H30N2O4/c1-2-6-23(29-21-13-11-20(12-14-21)27(32)28-16-15-25(30)31)22-17-24(18-7-4-3-5-8-18)33-26(22)19-9-10-19/h3-5,7-8,11-14,17,19,23,29H,2,6,9-10,15-16H2,1H3,(H,28,32)(H,30,31) |
| InChIKey | MSQJZAQWVGKGRU-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |