C25H28ClN3O4 — CID 59529586
3-[[4-[[1-[5-(2-chloro-4-pyridinyl)-2-methylfuran-3-yl]-3-methylbutyl]amino]benzoyl]amino]propanoic acid (PubChem CID 59529586) has the molecular formula C25H28ClN3O4 and a molecular weight of 469.97 g/mol. Its IUPAC name is 3-[[4-[[1-[5-(2-chloro-4-pyridinyl)-2-methylfuran-3-yl]-3-methylbutyl]amino]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[[1-[5-(2-chloro-4-pyridinyl)-2-methylfuran-3-yl]-3-methylbutyl]amino]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 59529586 |
| Molecular Formula | C25H28ClN3O4 |
| Molecular Weight | 469.97 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 3-[[4-[[1-[5-(2-chloro-4-pyridinyl)-2-methylfuran-3-yl]-3-methylbutyl]amino]benzoyl]amino]propanoic acid |
| SMILES | Cc1oc(-c2ccnc(Cl)c2)cc1C(CC(C)C)Nc1ccc(C(=O)NCCC(=O)O)cc1 |
| InChI | InChI=1S/C25H28ClN3O4/c1-15(2)12-21(20-14-22(33-16(20)3)18-8-10-27-23(26)13-18)29-19-6-4-17(5-7-19)25(32)28-11-9-24(30)31/h4-8,10,13-15,21,29H,9,11-12H2,1-3H3,(H,28,32)(H,30,31) |
| InChIKey | HEXJZLMKAVSYGA-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.97 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|