C24H27N3O3 — CID 71243807
3-[[4-[3-methyl-1-(quinolin-3-ylamino)butyl]benzoyl]amino]propanoic acid (PubChem CID 71243807) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is 3-[[4-[3-methyl-1-(quinolin-3-ylamino)butyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[3-methyl-1-(quinolin-3-ylamino)butyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 71243807 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 3-[[4-[3-methyl-1-(quinolin-3-ylamino)butyl]benzoyl]amino]propanoic acid |
| SMILES | CC(C)CC(Nc1cnc2ccccc2c1)c1ccc(C(=O)NCCC(=O)O)cc1 |
| InChI | InChI=1S/C24H27N3O3/c1-16(2)13-22(27-20-14-19-5-3-4-6-21(19)26-15-20)17-7-9-18(10-8-17)24(30)25-12-11-23(28)29/h3-10,14-16,22,27H,11-13H2,1-2H3,(H,25,30)(H,28,29) |
| InChIKey | CUAFDXZIZFDULP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |