C29H36N2O3S — CID 70870261
3-[[4-[[2-methyl-1-(2-methyl-5-phenylthiophen-3-yl)heptyl]amino]benzoyl]amino]propanoic acid (PubChem CID 70870261) has the molecular formula C29H36N2O3S and a molecular weight of 492.69 g/mol. Its IUPAC name is 3-[[4-[[2-methyl-1-(2-methyl-5-phenylthiophen-3-yl)heptyl]amino]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[[2-methyl-1-(2-methyl-5-phenylthiophen-3-yl)heptyl]amino]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 70870261 |
| Molecular Formula | C29H36N2O3S |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | 3-[[4-[[2-methyl-1-(2-methyl-5-phenylthiophen-3-yl)heptyl]amino]benzoyl]amino]propanoic acid |
| SMILES | CCCCCC(C)C(Nc1ccc(C(=O)NCCC(=O)O)cc1)c1cc(-c2ccccc2)sc1C |
| InChI | InChI=1S/C29H36N2O3S/c1-4-5-7-10-20(2)28(25-19-26(35-21(25)3)22-11-8-6-9-12-22)31-24-15-13-23(14-16-24)29(34)30-18-17-27(32)33/h6,8-9,11-16,19-20,28,31H,4-5,7,10,17-18H2,1-3H3,(H,30,34)(H,32,33) |
| InChIKey | PAEIGFCSULSHIF-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|