C34H43NO4 — CID 11606197
3-[[4-[1-[3,5-dimethyl-4-(4-propan-2-ylphenyl)phenoxy]heptyl]benzoyl]amino]propanoic acid (PubChem CID 11606197) has the molecular formula C34H43NO4 and a molecular weight of 529.72 g/mol. Its IUPAC name is 3-[[4-[1-[3,5-dimethyl-4-(4-propan-2-ylphenyl)phenoxy]heptyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[1-[3,5-dimethyl-4-(4-propan-2-ylphenyl)phenoxy]heptyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 11606197 |
| Molecular Formula | C34H43NO4 |
| Molecular Weight | 529.72 g/mol |
| Exact Mass | 529.32 |
| IUPAC Name | 3-[[4-[1-[3,5-dimethyl-4-(4-propan-2-ylphenyl)phenoxy]heptyl]benzoyl]amino]propanoic acid |
| SMILES | CCCCCCC(Oc1cc(C)c(-c2ccc(C(C)C)cc2)c(C)c1)c1ccc(C(=O)NCCC(=O)O)cc1 |
| InChI | InChI=1S/C34H43NO4/c1-6-7-8-9-10-31(27-13-17-29(18-14-27)34(38)35-20-19-32(36)37)39-30-21-24(4)33(25(5)22-30)28-15-11-26(12-16-28)23(2)3/h11-18,21-23,31H,6-10,19-20H2,1-5H3,(H,35,38)(H,36,37) |
| InChIKey | VMVYXTHWQQUOPC-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.72 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|