C25H27F4NO6 — CID 11677925
3-[[4-[1-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)oxy]heptyl]benzoyl]amino]propanoic acid (PubChem CID 11677925) has the molecular formula C25H27F4NO6 and a molecular weight of 513.48 g/mol. Its IUPAC name is 3-[[4-[1-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)oxy]heptyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[1-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)oxy]heptyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 11677925 |
| Molecular Formula | C25H27F4NO6 |
| Molecular Weight | 513.48 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | 3-[[4-[1-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)oxy]heptyl]benzoyl]amino]propanoic acid |
| SMILES | CCCCCCC(Oc1ccc2c(c1)OC(F)(F)C(F)(F)O2)c1ccc(C(=O)NCCC(=O)O)cc1 |
| InChI | InChI=1S/C25H27F4NO6/c1-2-3-4-5-6-19(16-7-9-17(10-8-16)23(33)30-14-13-22(31)32)34-18-11-12-20-21(15-18)36-25(28,29)24(26,27)35-20/h7-12,15,19H,2-6,13-14H2,1H3,(H,30,33)(H,31,32) |
| InChIKey | FIYNEGAABIBBTB-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.48 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|