C25H30N2O3S — CID 66777562
3-[[4-[[2-ethyl-1-(3-methyl-1-benzothiophen-2-yl)butyl]amino]benzoyl]amino]propanoic acid (PubChem CID 66777562) has the molecular formula C25H30N2O3S and a molecular weight of 438.59 g/mol. Its IUPAC name is 3-[[4-[[2-ethyl-1-(3-methyl-1-benzothiophen-2-yl)butyl]amino]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[[2-ethyl-1-(3-methyl-1-benzothiophen-2-yl)butyl]amino]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 66777562 |
| Molecular Formula | C25H30N2O3S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 3-[[4-[[2-ethyl-1-(3-methyl-1-benzothiophen-2-yl)butyl]amino]benzoyl]amino]propanoic acid |
| SMILES | CCC(CC)C(Nc1ccc(C(=O)NCCC(=O)O)cc1)c1sc2ccccc2c1C |
| InChI | InChI=1S/C25H30N2O3S/c1-4-17(5-2)23(24-16(3)20-8-6-7-9-21(20)31-24)27-19-12-10-18(11-13-19)25(30)26-15-14-22(28)29/h6-13,17,23,27H,4-5,14-15H2,1-3H3,(H,26,30)(H,28,29) |
| InChIKey | LFQIKBVGPVCRNV-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |