C23H23NO4 — CID 16650686
butyl 4-[(2-methyl-5-phenylfuran-3-carbonyl)amino]benzoate (PubChem CID 16650686) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is butyl 4-[(2-methyl-5-phenylfuran-3-carbonyl)amino]benzoate.
| Compound Name | butyl 4-[(2-methyl-5-phenylfuran-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 16650686 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | butyl 4-[(2-methyl-5-phenylfuran-3-carbonyl)amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)c2cc(-c3ccccc3)oc2C)cc1 |
| InChI | InChI=1S/C23H23NO4/c1-3-4-14-27-23(26)18-10-12-19(13-11-18)24-22(25)20-15-21(28-16(20)2)17-8-6-5-7-9-17/h5-13,15H,3-4,14H2,1-2H3,(H,24,25) |
| InChIKey | KYCFLGZOLPPKJT-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|