C20H25N3O3 — CID 91683073
butyl 4-[[5-amino-2-(dimethylamino)benzoyl]amino]benzoate (PubChem CID 91683073) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is butyl 4-[[5-amino-2-(dimethylamino)benzoyl]amino]benzoate.
| Compound Name | butyl 4-[[5-amino-2-(dimethylamino)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 91683073 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | butyl 4-[[5-amino-2-(dimethylamino)benzoyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)c2cc(N)ccc2N(C)C)cc1 |
| InChI | InChI=1S/C20H25N3O3/c1-4-5-12-26-20(25)14-6-9-16(10-7-14)22-19(24)17-13-15(21)8-11-18(17)23(2)3/h6-11,13H,4-5,12,21H2,1-3H3,(H,22,24) |
| InChIKey | HQZNVGHGQQHEIJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|