C17H21N3O — CID 61090008
5-amino-2-(dimethylamino)-N-(3,4-dimethylphenyl)benzamide (PubChem CID 61090008) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 5-amino-2-(dimethylamino)-N-(3,4-dimethylphenyl)benzamide.
| Compound Name | 5-amino-2-(dimethylamino)-N-(3,4-dimethylphenyl)benzamide |
|---|---|
| PubChem CID | 61090008 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 5-amino-2-(dimethylamino)-N-(3,4-dimethylphenyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cc(N)ccc2N(C)C)cc1C |
| InChI | InChI=1S/C17H21N3O/c1-11-5-7-14(9-12(11)2)19-17(21)15-10-13(18)6-8-16(15)20(3)4/h5-10H,18H2,1-4H3,(H,19,21) |
| InChIKey | ZCZAWKQEFUIQJJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|