C14H19N5O — CID 61090056
5-amino-2-(dimethylamino)-N-(2,5-dimethylpyrazol-3-yl)benzamide (PubChem CID 61090056) has the molecular formula C14H19N5O and a molecular weight of 273.34 g/mol. Its IUPAC name is 5-amino-2-(dimethylamino)-N-(2,5-dimethylpyrazol-3-yl)benzamide.
| Compound Name | 5-amino-2-(dimethylamino)-N-(2,5-dimethylpyrazol-3-yl)benzamide |
|---|---|
| PubChem CID | 61090056 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 5-amino-2-(dimethylamino)-N-(2,5-dimethylpyrazol-3-yl)benzamide |
| SMILES | Cc1cc(NC(=O)c2cc(N)ccc2N(C)C)n(C)n1 |
| InChI | InChI=1S/C14H19N5O/c1-9-7-13(19(4)17-9)16-14(20)11-8-10(15)5-6-12(11)18(2)3/h5-8H,15H2,1-4H3,(H,16,20) |
| InChIKey | GWIPHVOBZGSBSS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|