C13H15FN4O — CID 103295770
5-amino-N-(2,5-dimethylpyrazol-3-yl)-2-fluoro-3-methylbenzamide (PubChem CID 103295770) has the molecular formula C13H15FN4O and a molecular weight of 262.29 g/mol. Its IUPAC name is 5-amino-N-(2,5-dimethylpyrazol-3-yl)-2-fluoro-3-methylbenzamide.
| Compound Name | 5-amino-N-(2,5-dimethylpyrazol-3-yl)-2-fluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 103295770 |
| Molecular Formula | C13H15FN4O |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 5-amino-N-(2,5-dimethylpyrazol-3-yl)-2-fluoro-3-methylbenzamide |
| SMILES | Cc1cc(NC(=O)c2cc(N)cc(C)c2F)n(C)n1 |
| InChI | InChI=1S/C13H15FN4O/c1-7-4-9(15)6-10(12(7)14)13(19)16-11-5-8(2)17-18(11)3/h4-6H,15H2,1-3H3,(H,16,19) |
| InChIKey | KRYJFHIOHVQNMK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|