C12H14N4O2 — CID 62902933
5-amino-2-(dimethylamino)-N-(1,2-oxazol-3-yl)benzamide (PubChem CID 62902933) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 5-amino-2-(dimethylamino)-N-(1,2-oxazol-3-yl)benzamide.
| Compound Name | 5-amino-2-(dimethylamino)-N-(1,2-oxazol-3-yl)benzamide |
|---|---|
| PubChem CID | 62902933 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 5-amino-2-(dimethylamino)-N-(1,2-oxazol-3-yl)benzamide |
| SMILES | CN(C)c1ccc(N)cc1C(=O)Nc1ccon1 |
| InChI | InChI=1S/C12H14N4O2/c1-16(2)10-4-3-8(13)7-9(10)12(17)14-11-5-6-18-15-11/h3-7H,13H2,1-2H3,(H,14,15,17) |
| InChIKey | DREHYSTYTXSPDE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|