C23H22FNO4 — CID 16650910
butyl 4-[[5-(4-fluorophenyl)-2-methylfuran-3-carbonyl]amino]benzoate (PubChem CID 16650910) has the molecular formula C23H22FNO4 and a molecular weight of 395.43 g/mol. Its IUPAC name is butyl 4-[[5-(4-fluorophenyl)-2-methylfuran-3-carbonyl]amino]benzoate.
| Compound Name | butyl 4-[[5-(4-fluorophenyl)-2-methylfuran-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 16650910 |
| Molecular Formula | C23H22FNO4 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | butyl 4-[[5-(4-fluorophenyl)-2-methylfuran-3-carbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)c2cc(-c3ccc(F)cc3)oc2C)cc1 |
| InChI | InChI=1S/C23H22FNO4/c1-3-4-13-28-23(27)17-7-11-19(12-8-17)25-22(26)20-14-21(29-15(20)2)16-5-9-18(24)10-6-16/h5-12,14H,3-4,13H2,1-2H3,(H,25,26) |
| InChIKey | CSHVQUUPEMDODW-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|