C27H23FN2O4 — CID 100506456
butyl 4-[[2-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]benzoyl]amino]benzoate (PubChem CID 100506456) has the molecular formula C27H23FN2O4 and a molecular weight of 458.49 g/mol. Its IUPAC name is butyl 4-[[2-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]benzoyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 100506456 |
| Molecular Formula | C27H23FN2O4 |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | butyl 4-[[2-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]benzoyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)c2ccccc2-c2ncc(-c3ccc(F)cc3)o2)cc1 |
| InChI | InChI=1S/C27H23FN2O4/c1-2-3-16-33-27(32)19-10-14-21(15-11-19)30-25(31)22-6-4-5-7-23(22)26-29-17-24(34-26)18-8-12-20(28)13-9-18/h4-15,17H,2-3,16H2,1H3,(H,30,31) |
| InChIKey | ZUXSRCLMZOYHIS-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|