C25H22N2O3 — CID 100502272
N-(4-ethylphenyl)-2-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]benzamide (PubChem CID 100502272) has the molecular formula C25H22N2O3 and a molecular weight of 398.46 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]benzamide.
| Compound Name | N-(4-ethylphenyl)-2-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100502272 |
| Molecular Formula | C25H22N2O3 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | N-(4-ethylphenyl)-2-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]benzamide |
| SMILES | CCc1ccc(NC(=O)c2ccccc2-c2ncc(-c3ccc(OC)cc3)o2)cc1 |
| InChI | InChI=1S/C25H22N2O3/c1-3-17-8-12-19(13-9-17)27-24(28)21-6-4-5-7-22(21)25-26-16-23(30-25)18-10-14-20(29-2)15-11-18/h4-16H,3H2,1-2H3,(H,27,28) |
| InChIKey | VOWRBBSCLUQPTE-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |