C21H22N2O3 — CID 100501904
N-tert-butyl-2-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]benzamide (PubChem CID 100501904) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is N-tert-butyl-2-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]benzamide.
| Compound Name | N-tert-butyl-2-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100501904 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | N-tert-butyl-2-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]benzamide |
| SMILES | COc1ccc(-c2cnc(-c3ccccc3C(=O)NC(C)(C)C)o2)cc1 |
| InChI | InChI=1S/C21H22N2O3/c1-21(2,3)23-19(24)16-7-5-6-8-17(16)20-22-13-18(26-20)14-9-11-15(25-4)12-10-14/h5-13H,1-4H3,(H,23,24) |
| InChIKey | ACLWIVJSLYUGNO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |