C25H22N2O3 — CID 133150074
2-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]-N-(1-phenylethyl)benzamide (PubChem CID 133150074) has the molecular formula C25H22N2O3 and a molecular weight of 398.46 g/mol. Its IUPAC name is 2-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]-N-(1-phenylethyl)benzamide.
| Compound Name | 2-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 133150074 |
| Molecular Formula | C25H22N2O3 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 2-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]-N-(1-phenylethyl)benzamide |
| SMILES | COc1ccc(-c2cnc(-c3ccccc3C(=O)NC(C)c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C25H22N2O3/c1-17(18-8-4-3-5-9-18)27-24(28)21-10-6-7-11-22(21)25-26-16-23(30-25)19-12-14-20(29-2)15-13-19/h3-17H,1-2H3,(H,27,28) |
| InChIKey | UXAHFJALAWGYAU-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |