C31H26N2O4 — CID 100508470
N-benzhydryl-2-[5-(2,4-dimethoxyphenyl)-1,3-oxazol-2-yl]benzamide (PubChem CID 100508470) has the molecular formula C31H26N2O4 and a molecular weight of 490.56 g/mol. Its IUPAC name is N-benzhydryl-2-[5-(2,4-dimethoxyphenyl)-1,3-oxazol-2-yl]benzamide.
| Compound Name | N-benzhydryl-2-[5-(2,4-dimethoxyphenyl)-1,3-oxazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100508470 |
| Molecular Formula | C31H26N2O4 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | N-benzhydryl-2-[5-(2,4-dimethoxyphenyl)-1,3-oxazol-2-yl]benzamide |
| SMILES | COc1ccc(-c2cnc(-c3ccccc3C(=O)NC(c3ccccc3)c3ccccc3)o2)c(OC)c1 |
| InChI | InChI=1S/C31H26N2O4/c1-35-23-17-18-26(27(19-23)36-2)28-20-32-31(37-28)25-16-10-9-15-24(25)30(34)33-29(21-11-5-3-6-12-21)22-13-7-4-8-14-22/h3-20,29H,1-2H3,(H,33,34) |
| InChIKey | BIXCJAQTEACTDX-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |