C24H20N2O4 — CID 100506960
2-[5-(2,4-dimethoxyphenyl)-1,3-oxazol-2-yl]-N-phenylbenzamide (PubChem CID 100506960) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is 2-[5-(2,4-dimethoxyphenyl)-1,3-oxazol-2-yl]-N-phenylbenzamide.
| Compound Name | 2-[5-(2,4-dimethoxyphenyl)-1,3-oxazol-2-yl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 100506960 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 2-[5-(2,4-dimethoxyphenyl)-1,3-oxazol-2-yl]-N-phenylbenzamide |
| SMILES | COc1ccc(-c2cnc(-c3ccccc3C(=O)Nc3ccccc3)o2)c(OC)c1 |
| InChI | InChI=1S/C24H20N2O4/c1-28-17-12-13-20(21(14-17)29-2)22-15-25-24(30-22)19-11-7-6-10-18(19)23(27)26-16-8-4-3-5-9-16/h3-15H,1-2H3,(H,26,27) |
| InChIKey | CHPDZEFCIICUCL-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |