C24H21N3O6S — CID 100507780
2-[5-(2,4-dimethoxyphenyl)-1,3-oxazol-2-yl]-N-(4-sulfamoylphenyl)benzamide (PubChem CID 100507780) has the molecular formula C24H21N3O6S and a molecular weight of 479.51 g/mol. Its IUPAC name is 2-[5-(2,4-dimethoxyphenyl)-1,3-oxazol-2-yl]-N-(4-sulfamoylphenyl)benzamide.
| Compound Name | 2-[5-(2,4-dimethoxyphenyl)-1,3-oxazol-2-yl]-N-(4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 100507780 |
| Molecular Formula | C24H21N3O6S |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 2-[5-(2,4-dimethoxyphenyl)-1,3-oxazol-2-yl]-N-(4-sulfamoylphenyl)benzamide |
| SMILES | COc1ccc(-c2cnc(-c3ccccc3C(=O)Nc3ccc(S(N)(=O)=O)cc3)o2)c(OC)c1 |
| InChI | InChI=1S/C24H21N3O6S/c1-31-16-9-12-20(21(13-16)32-2)22-14-26-24(33-22)19-6-4-3-5-18(19)23(28)27-15-7-10-17(11-8-15)34(25,29)30/h3-14H,1-2H3,(H,27,28)(H2,25,29,30) |
| InChIKey | CNAJHFNCHUNWIU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 133.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |