C24H21N3O5S — CID 100504854
2-[5-(4-ethoxyphenyl)-1,3-oxazol-2-yl]-N-(4-sulfamoylphenyl)benzamide (PubChem CID 100504854) has the molecular formula C24H21N3O5S and a molecular weight of 463.52 g/mol. Its IUPAC name is 2-[5-(4-ethoxyphenyl)-1,3-oxazol-2-yl]-N-(4-sulfamoylphenyl)benzamide.
| Compound Name | 2-[5-(4-ethoxyphenyl)-1,3-oxazol-2-yl]-N-(4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 100504854 |
| Molecular Formula | C24H21N3O5S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 2-[5-(4-ethoxyphenyl)-1,3-oxazol-2-yl]-N-(4-sulfamoylphenyl)benzamide |
| SMILES | CCOc1ccc(-c2cnc(-c3ccccc3C(=O)Nc3ccc(S(N)(=O)=O)cc3)o2)cc1 |
| InChI | InChI=1S/C24H21N3O5S/c1-2-31-18-11-7-16(8-12-18)22-15-26-24(32-22)21-6-4-3-5-20(21)23(28)27-17-9-13-19(14-10-17)33(25,29)30/h3-15H,2H2,1H3,(H,27,28)(H2,25,29,30) |
| InChIKey | CQIPZZLZAZNOTA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |