C24H25NO4 — CID 16650811
butyl 4-[[2-methyl-5-(4-methylphenyl)furan-3-carbonyl]amino]benzoate (PubChem CID 16650811) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is butyl 4-[[2-methyl-5-(4-methylphenyl)furan-3-carbonyl]amino]benzoate.
| Compound Name | butyl 4-[[2-methyl-5-(4-methylphenyl)furan-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 16650811 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | butyl 4-[[2-methyl-5-(4-methylphenyl)furan-3-carbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)c2cc(-c3ccc(C)cc3)oc2C)cc1 |
| InChI | InChI=1S/C24H25NO4/c1-4-5-14-28-24(27)19-10-12-20(13-11-19)25-23(26)21-15-22(29-17(21)3)18-8-6-16(2)7-9-18/h6-13,15H,4-5,14H2,1-3H3,(H,25,26) |
| InChIKey | NCYWVCKNGRZOFA-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|