C20H18BrNO3 — CID 16651497
5-(4-bromophenyl)-N-(4-ethoxyphenyl)-2-methylfuran-3-carboxamide (PubChem CID 16651497) has the molecular formula C20H18BrNO3 and a molecular weight of 400.27 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N-(4-ethoxyphenyl)-2-methylfuran-3-carboxamide.
| Compound Name | 5-(4-bromophenyl)-N-(4-ethoxyphenyl)-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 16651497 |
| Molecular Formula | C20H18BrNO3 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 5-(4-bromophenyl)-N-(4-ethoxyphenyl)-2-methylfuran-3-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2cc(-c3ccc(Br)cc3)oc2C)cc1 |
| InChI | InChI=1S/C20H18BrNO3/c1-3-24-17-10-8-16(9-11-17)22-20(23)18-12-19(25-13(18)2)14-4-6-15(21)7-5-14/h4-12H,3H2,1-2H3,(H,22,23) |
| InChIKey | NFXUPONCBYWALR-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |