C18H12BrCl2NO2 — CID 18808826
N-(4-bromophenyl)-5-(3,5-dichlorophenyl)-2-methylfuran-3-carboxamide (PubChem CID 18808826) has the molecular formula C18H12BrCl2NO2 and a molecular weight of 425.11 g/mol. Its IUPAC name is N-(4-bromophenyl)-5-(3,5-dichlorophenyl)-2-methylfuran-3-carboxamide.
| Compound Name | N-(4-bromophenyl)-5-(3,5-dichlorophenyl)-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 18808826 |
| Molecular Formula | C18H12BrCl2NO2 |
| Molecular Weight | 425.11 g/mol |
| Exact Mass | 422.94 |
| IUPAC Name | N-(4-bromophenyl)-5-(3,5-dichlorophenyl)-2-methylfuran-3-carboxamide |
| SMILES | Cc1oc(-c2cc(Cl)cc(Cl)c2)cc1C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C18H12BrCl2NO2/c1-10-16(18(23)22-15-4-2-12(19)3-5-15)9-17(24-10)11-6-13(20)8-14(21)7-11/h2-9H,1H3,(H,22,23) |
| InChIKey | VECATDWWHGWXOS-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.11 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |